C19H38N2O2 — CID 170039525
N-[[6-[(2,2-dimethylpropylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methyl]-4-methylpentan-1-amine (PubChem CID 170039525) has the molecular formula C19H38N2O2 and a molecular weight of 326.52 g/mol. Its IUPAC name is N-[[6-[(2,2-dimethylpropylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methyl]-4-methylpentan-1-amine.
| Compound Name | N-[[6-[(2,2-dimethylpropylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 170039525 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N-[[6-[(2,2-dimethylpropylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CCCNCC1COC2C(CNCC(C)(C)C)COC12 |
| InChI | InChI=1S/C19H38N2O2/c1-14(2)7-6-8-20-9-15-11-22-18-16(12-23-17(15)18)10-21-13-19(3,4)5/h14-18,20-21H,6-13H2,1-5H3 |
| InChIKey | PZEZCJWDBZQDKQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|