C17H23N5O — CID 170042520
3-(4-aminophenyl)-1-tert-butyl-5-(prop-1-en-2-ylamino)pyrazole-4-carboxamide (PubChem CID 170042520) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1-tert-butyl-5-(prop-1-en-2-ylamino)pyrazole-4-carboxamide.
| Compound Name | 3-(4-aminophenyl)-1-tert-butyl-5-(prop-1-en-2-ylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170042520 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 3-(4-aminophenyl)-1-tert-butyl-5-(prop-1-en-2-ylamino)pyrazole-4-carboxamide |
| SMILES | C=C(C)Nc1c(C(N)=O)c(-c2ccc(N)cc2)nn1C(C)(C)C |
| InChI | InChI=1S/C17H23N5O/c1-10(2)20-16-13(15(19)23)14(21-22(16)17(3,4)5)11-6-8-12(18)9-7-11/h6-9,20H,1,18H2,2-5H3,(H2,19,23) |
| InChIKey | XDKXELRMGFFNGK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|