C22H23F2N5O — CID 170042774
2-[9-[(1R)-3,3-difluorocyclopentyl]-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-3-yl]-5-pyrazol-1-ylphenol (PubChem CID 170042774) has the molecular formula C22H23F2N5O and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[9-[(1R)-3,3-difluorocyclopentyl]-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-3-yl]-5-pyrazol-1-ylphenol.
| Compound Name | 2-[9-[(1R)-3,3-difluorocyclopentyl]-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-3-yl]-5-pyrazol-1-ylphenol |
|---|---|
| PubChem CID | 170042774 |
| Molecular Formula | C22H23F2N5O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-[9-[(1R)-3,3-difluorocyclopentyl]-5,6,7,8-tetrahydropyridazino[3,4-b]azepin-3-yl]-5-pyrazol-1-ylphenol |
| SMILES | Oc1cc(-n2cccn2)ccc1-c1cc2c(nn1)N([C@@H]1CCC(F)(F)C1)CCCC2 |
| InChI | InChI=1S/C22H23F2N5O/c23-22(24)8-7-17(14-22)28-10-2-1-4-15-12-19(26-27-21(15)28)18-6-5-16(13-20(18)30)29-11-3-9-25-29/h3,5-6,9,11-13,17,30H,1-2,4,7-8,10,14H2/t17-/m1/s1 |
| InChIKey | YDMSRRFMLKPIJW-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |