About methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate
methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate (PubChem CID 170042823) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate |
| PubChem CID | 170042823 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate |
| SMILES | CCc1ccc2c(n1)c(CC(=O)OC)cn2C |
| InChI | InChI=1S/C13H16N2O2/c1-4-10-5-6-11-13(14-10)9(8-15(11)2)7-12(16)17-3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | WAQACFZVDALVOA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate?
The IUPAC name of methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate (CID 170042823) is methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate.
What is the SMILES notation for methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate?
The canonical SMILES for methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate is CCc1ccc2c(n1)c(CC(=O)OC)cn2C.
What is the InChIKey of methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate?
The InChIKey is WAQACFZVDALVOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-4-10-5-6-11-13(14-10)9(8-15(11)2)7-12(16)17-3/h5-6,8H,4,7H2,1-3H3.
What are the key properties of methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate?
methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate has a molecular weight of 232.28 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-ethyl-1-methylpyrrolo[3,2-b]pyridin-3-yl)acetate is sourced from PubChem (CID 170042823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).