About N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide
N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 170043554) has the molecular formula C11H14F3NO2
and a molecular weight of 249.23 g/mol. Its IUPAC name is N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 170043554 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC(C)NC(=O)C1C=CC(OC(F)(F)F)=CC1 |
| InChI | InChI=1S/C11H14F3NO2/c1-7(2)15-10(16)8-3-5-9(6-4-8)17-11(12,13)14/h3,5-8H,4H2,1-2H3,(H,15,16) |
| InChIKey | SKGAVJBLAAVLSW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide (CID 170043554) is N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide is CC(C)NC(=O)C1C=CC(OC(F)(F)F)=CC1.
What is the InChIKey of N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide?
The InChIKey is SKGAVJBLAAVLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO2/c1-7(2)15-10(16)8-3-5-9(6-4-8)17-11(12,13)14/h3,5-8H,4H2,1-2H3,(H,15,16).
What are the key properties of N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide?
N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide has a molecular weight of 249.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-4-(trifluoromethoxy)cyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 170043554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).