About 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole
3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole (PubChem CID 170043562) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole |
| PubChem CID | 170043562 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole |
| SMILES | Cc1nn(C2C=CC(C(C)C)=CC2)c(C)c1C(C)C |
| InChI | InChI=1S/C17H26N2/c1-11(2)15-7-9-16(10-8-15)19-14(6)17(12(3)4)13(5)18-19/h7-9,11-12,16H,10H2,1-6H3 |
| InChIKey | GZXAWMKDTZUYFN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole?
The IUPAC name of 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole (CID 170043562) is 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole.
What is the SMILES notation for 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole?
The canonical SMILES for 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole is Cc1nn(C2C=CC(C(C)C)=CC2)c(C)c1C(C)C.
What is the InChIKey of 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole?
The InChIKey is GZXAWMKDTZUYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2/c1-11(2)15-7-9-16(10-8-15)19-14(6)17(12(3)4)13(5)18-19/h7-9,11-12,16H,10H2,1-6H3.
What are the key properties of 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole?
3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole has a molecular weight of 258.41 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-propan-2-yl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)pyrazole is sourced from PubChem (CID 170043562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).