C30H34N8O2 — CID 170044147
1-[(8R)-8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl]-6-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 170044147) has the molecular formula C30H34N8O2 and a molecular weight of 538.66 g/mol. Its IUPAC name is 1-[(8R)-8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl]-6-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[(8R)-8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl]-6-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 170044147 |
| Molecular Formula | C30H34N8O2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 1-[(8R)-8-hydroxy-8-methyl-6,7-dihydro-5H-quinolin-2-yl]-6-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4C[C@@H]5C[C@H]4CN5C)cc3)nc2n1-c1ccc2c(n1)[C@](C)(O)CCC2 |
| InChI | InChI=1S/C30H34N8O2/c1-4-14-37-28(39)24-16-31-29(32-20-8-10-21(11-9-20)36-18-22-15-23(36)17-35(22)3)34-27(24)38(37)25-12-7-19-6-5-13-30(2,40)26(19)33-25/h4,7-12,16,22-23,40H,1,5-6,13-15,17-18H2,2-3H3,(H,31,32,34)/t22-,23-,30+/m0/s1 |
| InChIKey | BEJIKIHLPOKNNA-ZTNZZFSWSA-N |
| XLogP | 3.34 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|