About 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine
4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine (PubChem CID 170045045) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine |
| PubChem CID | 170045045 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine |
| SMILES | COC1C=C(C)CCC(N2CCOCC2)=C1 |
| InChI | InChI=1S/C13H21NO2/c1-11-3-4-12(10-13(9-11)15-2)14-5-7-16-8-6-14/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | LERXBNRGTMNMIT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine?
The IUPAC name of 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine (CID 170045045) is 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine.
What is the SMILES notation for 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine?
The canonical SMILES for 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine is COC1C=C(C)CCC(N2CCOCC2)=C1.
What is the InChIKey of 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine?
The InChIKey is LERXBNRGTMNMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-11-3-4-12(10-13(9-11)15-2)14-5-7-16-8-6-14/h9-10,13H,3-8H2,1-2H3.
What are the key properties of 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine?
4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine has a molecular weight of 223.32 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxy-5-methylcyclohepta-1,4-dien-1-yl)morpholine is sourced from PubChem (CID 170045045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).