About N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine
N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine (PubChem CID 170045205) has the molecular formula C10H15F2N4P
and a molecular weight of 260.23 g/mol. Its IUPAC name is N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine |
| PubChem CID | 170045205 |
| Molecular Formula | C10H15F2N4P |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CN(CC(F)(F)P)C2)ncn1 |
| InChI | InChI=1S/C10H15F2N4P/c1-7-2-9(14-6-13-7)15-8-3-16(4-8)5-10(11,12)17/h2,6,8H,3-5,17H2,1H3,(H,13,14,15) |
| InChIKey | SIRBLKQSUXKTCG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine?
The IUPAC name of N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine (CID 170045205) is N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine.
What is the SMILES notation for N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine?
The canonical SMILES for N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine is Cc1cc(NC2CN(CC(F)(F)P)C2)ncn1.
What is the InChIKey of N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine?
The InChIKey is SIRBLKQSUXKTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N4P/c1-7-2-9(14-6-13-7)15-8-3-16(4-8)5-10(11,12)17/h2,6,8H,3-5,17H2,1H3,(H,13,14,15).
What are the key properties of N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine?
N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine has a molecular weight of 260.23 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2-difluoro-2-phosphanylethyl)azetidin-3-yl]-6-methylpyrimidin-4-amine is sourced from PubChem (CID 170045205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).