C11H16O — CID 170045955
6-propan-2-yl-1,3,3a,4-tetrahydro-2-benzofuran (PubChem CID 170045955) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-propan-2-yl-1,3,3a,4-tetrahydro-2-benzofuran.
| Compound Name | 6-propan-2-yl-1,3,3a,4-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 170045955 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 6-propan-2-yl-1,3,3a,4-tetrahydro-2-benzofuran |
| SMILES | CC(C)C1=CCC2COCC2=C1 |
| InChI | InChI=1S/C11H16O/c1-8(2)9-3-4-10-6-12-7-11(10)5-9/h3,5,8,10H,4,6-7H2,1-2H3 |
| InChIKey | ZCUNGFQSJOJACR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |