About N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide
N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide (PubChem CID 170046310) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide.
Molecular Properties
| Compound Name | N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide |
| PubChem CID | 170046310 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide |
| SMILES | C/C=C\C=C(/N=C/N)C(C)CC |
| InChI | InChI=1S/C10H18N2/c1-4-6-7-10(12-8-11)9(3)5-2/h4,6-9H,5H2,1-3H3,(H2,11,12)/b6-4-,10-7- |
| InChIKey | UNXDRGMQQFNDEI-KFUKRSJGSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide?
The IUPAC name of N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide (CID 170046310) is N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide.
What is the SMILES notation for N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide?
The canonical SMILES for N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide is C/C=C\C=C(/N=C/N)C(C)CC.
What is the InChIKey of N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide?
The InChIKey is UNXDRGMQQFNDEI-KFUKRSJGSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-6-7-10(12-8-11)9(3)5-2/h4,6-9H,5H2,1-3H3,(H2,11,12)/b6-4-,10-7-.
What are the key properties of N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide?
N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide has a molecular weight of 166.27 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(4Z,6Z)-3-methylocta-4,6-dien-4-yl]methanimidamide is sourced from PubChem (CID 170046310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).