C21H13Cl2F2N5O5 — CID 170047103
2-[3,5-dichloro-4-[[2-(difluoromethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 170047103) has the molecular formula C21H13Cl2F2N5O5 and a molecular weight of 524.27 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[2-(difluoromethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[2-(difluoromethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 170047103 |
| Molecular Formula | C21H13Cl2F2N5O5 |
| Molecular Weight | 524.27 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[[2-(difluoromethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3ccc4c(c3)CCN(COC(F)F)C4=O)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H13Cl2F2N5O5/c22-14-6-11(30-21(33)27-18(31)16(8-26)28-30)7-15(23)17(14)35-12-1-2-13-10(5-12)3-4-29(19(13)32)9-34-20(24)25/h1-2,5-7,20H,3-4,9H2,(H,27,31,33) |
| InChIKey | HVGXVGWEMWYFKE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |