C16H24N2O3 — CID 170047241
2-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)-1,2-oxazol-5-yl]-3-methylbutanal (PubChem CID 170047241) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)-1,2-oxazol-5-yl]-3-methylbutanal.
| Compound Name | 2-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)-1,2-oxazol-5-yl]-3-methylbutanal |
|---|---|
| PubChem CID | 170047241 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethoxy)-1,2-oxazol-5-yl]-3-methylbutanal |
| SMILES | CC(C)C(C=O)c1cc(OCC2CCC3CCCN32)no1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)14(9-19)15-8-16(17-21-15)20-10-13-6-5-12-4-3-7-18(12)13/h8-9,11-14H,3-7,10H2,1-2H3 |
| InChIKey | MGNDIIUYAGCFET-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|