C32H13F15 — CID 170047716
1-[bis(4-ethenyl-2,3,5,6-tetrafluorophenyl)-(3-ethenyl-2,4,5-trifluorocyclopenta-2,4-dien-1-yl)methyl]-4-ethenyl-2,3,5,6-tetrafluorobenzene (PubChem CID 170047716) has the molecular formula C32H13F15 and a molecular weight of 682.43 g/mol. Its IUPAC name is 1-[bis(4-ethenyl-2,3,5,6-tetrafluorophenyl)-(3-ethenyl-2,4,5-trifluorocyclopenta-2,4-dien-1-yl)methyl]-4-ethenyl-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-[bis(4-ethenyl-2,3,5,6-tetrafluorophenyl)-(3-ethenyl-2,4,5-trifluorocyclopenta-2,4-dien-1-yl)methyl]-4-ethenyl-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 170047716 |
| Molecular Formula | C32H13F15 |
| Molecular Weight | 682.43 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | 1-[bis(4-ethenyl-2,3,5,6-tetrafluorophenyl)-(3-ethenyl-2,4,5-trifluorocyclopenta-2,4-dien-1-yl)methyl]-4-ethenyl-2,3,5,6-tetrafluorobenzene |
| SMILES | C=CC1=C(F)C(C(c2c(F)c(F)c(C=C)c(F)c2F)(c2c(F)c(F)c(C=C)c(F)c2F)c2c(F)c(F)c(C=C)c(F)c2F)C(F)=C1F |
| InChI | InChI=1S/C32H13F15/c1-5-9-17(33)13(25(41)18(9)34)32(14-26(42)19(35)10(6-2)20(36)27(14)43,15-28(44)21(37)11(7-3)22(38)29(15)45)16-30(46)23(39)12(8-4)24(40)31(16)47/h5-8,13H,1-4H2 |
| InChIKey | FUGZIVRCNCMDHQ-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.43 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|