C29H48N4O — CID 170047957
5-ethyl-2-[4-[(3E,5E,7Z)-6-ethyl-5-methoxy-3-methylnona-3,5,7-trien-2-yl]piperazin-1-yl]-4-[(3R)-3-methylpentyl]pyrimidine (PubChem CID 170047957) has the molecular formula C29H48N4O and a molecular weight of 468.73 g/mol. Its IUPAC name is 5-ethyl-2-[4-[(3E,5E,7Z)-6-ethyl-5-methoxy-3-methylnona-3,5,7-trien-2-yl]piperazin-1-yl]-4-[(3R)-3-methylpentyl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[(3E,5E,7Z)-6-ethyl-5-methoxy-3-methylnona-3,5,7-trien-2-yl]piperazin-1-yl]-4-[(3R)-3-methylpentyl]pyrimidine |
|---|---|
| PubChem CID | 170047957 |
| Molecular Formula | C29H48N4O |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | 5-ethyl-2-[4-[(3E,5E,7Z)-6-ethyl-5-methoxy-3-methylnona-3,5,7-trien-2-yl]piperazin-1-yl]-4-[(3R)-3-methylpentyl]pyrimidine |
| SMILES | C/C=C\C(CC)=C(/C=C(\C)C(C)N1CCN(c2ncc(CC)c(CC[C@H](C)CC)n2)CC1)OC |
| InChI | InChI=1S/C29H48N4O/c1-9-13-25(11-3)28(34-8)20-23(6)24(7)32-16-18-33(19-17-32)29-30-21-26(12-4)27(31-29)15-14-22(5)10-2/h9,13,20-22,24H,10-12,14-19H2,1-8H3/b13-9-,23-20+,28-25+/t22-,24?/m1/s1 |
| InChIKey | RQJNDVHLXADHCR-VXUYTLOMSA-N |
| XLogP | 6.36 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|