About 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide
5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 170048475) has the molecular formula C12H15FN4O
and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| PubChem CID | 170048475 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN[C@@H]3CC32)c(F)n1 |
| InChI | InChI=1S/C12H15FN4O/c1-14-12(18)7-2-3-9(11(13)16-7)17-5-4-15-8-6-10(8)17/h2-3,8,10,15H,4-6H2,1H3,(H,14,18)/t8-,10?/m1/s1 |
| InChIKey | RCVWOUJIRIRQBV-HNHGDDPOSA-N |
| XLogP | 0.13 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide?
The IUPAC name of 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide (CID 170048475) is 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide?
The canonical SMILES for 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide is CNC(=O)c1ccc(N2CCN[C@@H]3CC32)c(F)n1.
What is the InChIKey of 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide?
The InChIKey is RCVWOUJIRIRQBV-HNHGDDPOSA-N. The full InChI is InChI=1S/C12H15FN4O/c1-14-12(18)7-2-3-9(11(13)16-7)17-5-4-15-8-6-10(8)17/h2-3,8,10,15H,4-6H2,1H3,(H,14,18)/t8-,10?/m1/s1.
What are the key properties of 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide?
5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide has a molecular weight of 250.28 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6R)-2,5-diazabicyclo[4.1.0]heptan-2-yl]-6-fluoro-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 170048475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).