C15H19N — CID 170049119
2-methylidene-6-[(1Z,3Z,7Z)-nona-1,3,7-trienyl]-1H-pyridine (PubChem CID 170049119) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methylidene-6-[(1Z,3Z,7Z)-nona-1,3,7-trienyl]-1H-pyridine.
| Compound Name | 2-methylidene-6-[(1Z,3Z,7Z)-nona-1,3,7-trienyl]-1H-pyridine |
|---|---|
| PubChem CID | 170049119 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-methylidene-6-[(1Z,3Z,7Z)-nona-1,3,7-trienyl]-1H-pyridine |
| SMILES | C=C1C=CC=C(/C=C\C=C/CC/C=C\C)N1 |
| InChI | InChI=1S/C15H19N/c1-3-4-5-6-7-8-9-12-15-13-10-11-14(2)16-15/h3-4,7-13,16H,2,5-6H2,1H3/b4-3-,8-7-,12-9- |
| InChIKey | QONLPCCTCFQSRN-DSFIMQIWSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|