C13H20OS — CID 170050280
1-(2,3-dimethylbutoxy)-4-methylsulfanylbenzene (PubChem CID 170050280) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(2,3-dimethylbutoxy)-4-methylsulfanylbenzene.
| Compound Name | 1-(2,3-dimethylbutoxy)-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 170050280 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(2,3-dimethylbutoxy)-4-methylsulfanylbenzene |
| SMILES | CSc1ccc(OCC(C)C(C)C)cc1 |
| InChI | InChI=1S/C13H20OS/c1-10(2)11(3)9-14-12-5-7-13(15-4)8-6-12/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | SOTRYONBABCRCI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |