C12H18S — CID 170050507
(3Z,5E)-3,5-dimethyl-6-prop-1-en-2-ylsulfanylhepta-1,3,5-triene (PubChem CID 170050507) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is (3Z,5E)-3,5-dimethyl-6-prop-1-en-2-ylsulfanylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-3,5-dimethyl-6-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 170050507 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3Z,5E)-3,5-dimethyl-6-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C(C)=C(/C)SC(=C)C |
| InChI | InChI=1S/C12H18S/c1-7-10(4)8-11(5)12(6)13-9(2)3/h7-8H,1-2H2,3-6H3/b10-8-,12-11+ |
| InChIKey | UDBVIOROVMPRBI-SHCMDWHWSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|