C19H20ClN3O2 — CID 170050610
4-[[2-(2-chlorophenyl)acetyl]amino]-N-(1-ethylcyclopropyl)pyridine-2-carboxamide (PubChem CID 170050610) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-[[2-(2-chlorophenyl)acetyl]amino]-N-(1-ethylcyclopropyl)pyridine-2-carboxamide.
| Compound Name | 4-[[2-(2-chlorophenyl)acetyl]amino]-N-(1-ethylcyclopropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170050610 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[[2-(2-chlorophenyl)acetyl]amino]-N-(1-ethylcyclopropyl)pyridine-2-carboxamide |
| SMILES | CCC1(NC(=O)c2cc(NC(=O)Cc3ccccc3Cl)ccn2)CC1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-2-19(8-9-19)23-18(25)16-12-14(7-10-21-16)22-17(24)11-13-5-3-4-6-15(13)20/h3-7,10,12H,2,8-9,11H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | LCYPQZUTQVAQID-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |