C33H33FN4O6 — CID 170050817
benzyl (E,4S)-4-[[2-[[(2R)-2-[(3-fluorobenzoyl)amino]propanoyl]amino]benzoyl]amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate (PubChem CID 170050817) has the molecular formula C33H33FN4O6 and a molecular weight of 600.65 g/mol. Its IUPAC name is benzyl (E,4S)-4-[[2-[[(2R)-2-[(3-fluorobenzoyl)amino]propanoyl]amino]benzoyl]amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate.
| Compound Name | benzyl (E,4S)-4-[[2-[[(2R)-2-[(3-fluorobenzoyl)amino]propanoyl]amino]benzoyl]amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 170050817 |
| Molecular Formula | C33H33FN4O6 |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | benzyl (E,4S)-4-[[2-[[(2R)-2-[(3-fluorobenzoyl)amino]propanoyl]amino]benzoyl]amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
| SMILES | C[C@@H](NC(=O)c1cccc(F)c1)C(=O)Nc1ccccc1C(=O)N[C@H](/C=C/C(=O)OCc1ccccc1)CC1CCNC1=O |
| InChI | InChI=1S/C33H33FN4O6/c1-21(36-32(42)23-10-7-11-25(34)18-23)30(40)38-28-13-6-5-12-27(28)33(43)37-26(19-24-16-17-35-31(24)41)14-15-29(39)44-20-22-8-3-2-4-9-22/h2-15,18,21,24,26H,16-17,19-20H2,1H3,(H,35,41)(H,36,42)(H,37,43)(H,38,40)/b15-14+/t21-,24?,26-/m1/s1 |
| InChIKey | QMMKSJSORIDACC-KOPRZSSVSA-N |
| XLogP | 3.51 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|