About (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine
(2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine (PubChem CID 170050973) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine.
Molecular Properties
| Compound Name | (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine |
| PubChem CID | 170050973 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine |
| SMILES | C=C(/N=C/C(=C\C)CCCC(C)C)C(C)(C)CC |
| InChI | InChI=1S/C17H31N/c1-8-16(12-10-11-14(3)4)13-18-15(5)17(6,7)9-2/h8,13-14H,5,9-12H2,1-4,6-7H3/b16-8-,18-13+ |
| InChIKey | YTBOVHCOKZDORA-VWEIEBQISA-N |
| XLogP | 5.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine?
The IUPAC name of (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine (CID 170050973) is (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine.
What is the SMILES notation for (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine?
The canonical SMILES for (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine is C=C(/N=C/C(=C\C)CCCC(C)C)C(C)(C)CC.
What is the InChIKey of (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine?
The InChIKey is YTBOVHCOKZDORA-VWEIEBQISA-N. The full InChI is InChI=1S/C17H31N/c1-8-16(12-10-11-14(3)4)13-18-15(5)17(6,7)9-2/h8,13-14H,5,9-12H2,1-4,6-7H3/b16-8-,18-13+.
What are the key properties of (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine?
(2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine has a molecular weight of 249.44 g/mol, XLogP of 5.78, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-(3,3-dimethylpent-1-en-2-yl)-2-ethylidene-6-methylheptan-1-imine is sourced from PubChem (CID 170050973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).