C34H39N3O3 — CID 17005117
1-(4-butylphenyl)-4-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17005117) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is 1-(4-butylphenyl)-4-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(4-butylphenyl)-4-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005117 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 1-(4-butylphenyl)-4-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | C=CCc1ccc(OCCCn2c(C3CC(=O)N(c4ccc(CCCC)cc4)C3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C34H39N3O3/c1-4-6-11-25-14-17-28(18-15-25)37-24-27(23-33(37)38)34-35-29-12-7-8-13-30(29)36(34)20-9-21-40-31-19-16-26(10-5-2)22-32(31)39-3/h5,7-8,12-19,22,27H,2,4,6,9-11,20-21,23-24H2,1,3H3 |
| InChIKey | NTXOVRLJQABXFR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|