C17H18BrNO2S — CID 170051181
3-(benzenesulfonyl)-3-(4-bromophenyl)-1-methylpyrrolidine (PubChem CID 170051181) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-3-(4-bromophenyl)-1-methylpyrrolidine.
| Compound Name | 3-(benzenesulfonyl)-3-(4-bromophenyl)-1-methylpyrrolidine |
|---|---|
| PubChem CID | 170051181 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 3-(benzenesulfonyl)-3-(4-bromophenyl)-1-methylpyrrolidine |
| SMILES | CN1CCC(c2ccc(Br)cc2)(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H18BrNO2S/c1-19-12-11-17(13-19,14-7-9-15(18)10-8-14)22(20,21)16-5-3-2-4-6-16/h2-10H,11-13H2,1H3 |
| InChIKey | YBTXZUHQLAZNHO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |