C20H27FO4 — CID 170051936
methyl 2-[2-(4-fluorophenyl)ethyl]-3,5,6,7-tetramethyl-4-oxooxepane-3-carboxylate (PubChem CID 170051936) has the molecular formula C20H27FO4 and a molecular weight of 350.43 g/mol. Its IUPAC name is methyl 2-[2-(4-fluorophenyl)ethyl]-3,5,6,7-tetramethyl-4-oxooxepane-3-carboxylate.
| Compound Name | methyl 2-[2-(4-fluorophenyl)ethyl]-3,5,6,7-tetramethyl-4-oxooxepane-3-carboxylate |
|---|---|
| PubChem CID | 170051936 |
| Molecular Formula | C20H27FO4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl 2-[2-(4-fluorophenyl)ethyl]-3,5,6,7-tetramethyl-4-oxooxepane-3-carboxylate |
| SMILES | COC(=O)C1(C)C(=O)C(C)C(C)C(C)OC1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FO4/c1-12-13(2)18(22)20(4,19(23)24-5)17(25-14(12)3)11-8-15-6-9-16(21)10-7-15/h6-7,9-10,12-14,17H,8,11H2,1-5H3 |
| InChIKey | QRLOLQDNGBGZPI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|