C16H28P2 — CID 170052136
[(2E,4E)-4-tert-butyl-2-ethenyl-1-ethylphosphanylhepta-2,4,6-trienyl]-methylphosphane (PubChem CID 170052136) has the molecular formula C16H28P2 and a molecular weight of 282.35 g/mol. Its IUPAC name is [(2E,4E)-4-tert-butyl-2-ethenyl-1-ethylphosphanylhepta-2,4,6-trienyl]-methylphosphane.
| Compound Name | [(2E,4E)-4-tert-butyl-2-ethenyl-1-ethylphosphanylhepta-2,4,6-trienyl]-methylphosphane |
|---|---|
| PubChem CID | 170052136 |
| Molecular Formula | C16H28P2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [(2E,4E)-4-tert-butyl-2-ethenyl-1-ethylphosphanylhepta-2,4,6-trienyl]-methylphosphane |
| SMILES | C=C/C=C(\C=C(/C=C)C(PC)PCC)C(C)(C)C |
| InChI | InChI=1S/C16H28P2/c1-8-11-14(16(4,5)6)12-13(9-2)15(17-7)18-10-3/h8-9,11-12,15,17-18H,1-2,10H2,3-7H3/b13-12+,14-11+ |
| InChIKey | KRDNFOUYNCCART-UIGAKZAYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|