C23H38F3NO — CID 170052659
N-[(2E,4Z)-5,6-dimethyl-1-(3-methylbutoxy)-3-(trifluoromethyl)octa-2,4-dien-4-yl]-N-ethenyl-3-methylcyclobutan-1-amine (PubChem CID 170052659) has the molecular formula C23H38F3NO and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[(2E,4Z)-5,6-dimethyl-1-(3-methylbutoxy)-3-(trifluoromethyl)octa-2,4-dien-4-yl]-N-ethenyl-3-methylcyclobutan-1-amine.
| Compound Name | N-[(2E,4Z)-5,6-dimethyl-1-(3-methylbutoxy)-3-(trifluoromethyl)octa-2,4-dien-4-yl]-N-ethenyl-3-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 170052659 |
| Molecular Formula | C23H38F3NO |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | N-[(2E,4Z)-5,6-dimethyl-1-(3-methylbutoxy)-3-(trifluoromethyl)octa-2,4-dien-4-yl]-N-ethenyl-3-methylcyclobutan-1-amine |
| SMILES | C=CN(C(=C(/C)C(C)CC)/C(=C\COCCC(C)C)C(F)(F)F)C1CC(C)C1 |
| InChI | InChI=1S/C23H38F3NO/c1-8-18(6)19(7)22(27(9-2)20-14-17(5)15-20)21(23(24,25)26)11-13-28-12-10-16(3)4/h9,11,16-18,20H,2,8,10,12-15H2,1,3-7H3/b21-11+,22-19- |
| InChIKey | ACLRENWEJMBSSG-ZORVMIJESA-N |
| XLogP | 7.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|