C22H34F2N2O2 — CID 170053013
(6E,8R)-8-(ethoxymethyl)-6-(fluoromethylidene)-5-[2-[[(6Z,8R)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 170053013) has the molecular formula C22H34F2N2O2 and a molecular weight of 396.52 g/mol. Its IUPAC name is (6E,8R)-8-(ethoxymethyl)-6-(fluoromethylidene)-5-[2-[[(6Z,8R)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | (6E,8R)-8-(ethoxymethyl)-6-(fluoromethylidene)-5-[2-[[(6Z,8R)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 170053013 |
| Molecular Formula | C22H34F2N2O2 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (6E,8R)-8-(ethoxymethyl)-6-(fluoromethylidene)-5-[2-[[(6Z,8R)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | CCOC[C@]12CCCN1C(CCOC[C@]13CCCN1C/C(=C\F)C3)/C(=C/F)C2 |
| InChI | InChI=1S/C22H34F2N2O2/c1-2-27-17-22-7-4-9-26(22)20(19(12-22)14-24)5-10-28-16-21-6-3-8-25(21)15-18(11-21)13-23/h13-14,20H,2-12,15-17H2,1H3/b18-13-,19-14+/t20?,21-,22-/m1/s1 |
| InChIKey | IGTJTYZOBFSPOJ-OKUWARIPSA-N |
| XLogP | 3.98 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|