C20H17Br — CID 170053448
(9S)-2-bromo-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9H-fluorene (PubChem CID 170053448) has the molecular formula C20H17Br and a molecular weight of 337.26 g/mol. Its IUPAC name is (9S)-2-bromo-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9H-fluorene.
| Compound Name | (9S)-2-bromo-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9H-fluorene |
|---|---|
| PubChem CID | 170053448 |
| Molecular Formula | C20H17Br |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (9S)-2-bromo-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9H-fluorene |
| SMILES | C=C/C=C\C=C(/C)[C@H]1c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C20H17Br/c1-3-4-5-8-14(2)20-18-10-7-6-9-16(18)17-12-11-15(21)13-19(17)20/h3-13,20H,1H2,2H3/b5-4-,14-8+/t20-/m0/s1 |
| InChIKey | WYKNDBKQDPTGMM-OZAUYDQNSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|