About 1-but-1-en-2-yl-1,3-dimethylurea
1-but-1-en-2-yl-1,3-dimethylurea (PubChem CID 170053729) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-but-1-en-2-yl-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-but-1-en-2-yl-1,3-dimethylurea |
| PubChem CID | 170053729 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-but-1-en-2-yl-1,3-dimethylurea |
| SMILES | C=C(CC)N(C)C(=O)NC |
| InChI | InChI=1S/C7H14N2O/c1-5-6(2)9(4)7(10)8-3/h2,5H2,1,3-4H3,(H,8,10) |
| InChIKey | KDQABXSQFCHBML-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-but-1-en-2-yl-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yl-1,3-dimethylurea?
The IUPAC name of 1-but-1-en-2-yl-1,3-dimethylurea (CID 170053729) is 1-but-1-en-2-yl-1,3-dimethylurea.
What is the SMILES notation for 1-but-1-en-2-yl-1,3-dimethylurea?
The canonical SMILES for 1-but-1-en-2-yl-1,3-dimethylurea is C=C(CC)N(C)C(=O)NC.
What is the InChIKey of 1-but-1-en-2-yl-1,3-dimethylurea?
The InChIKey is KDQABXSQFCHBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5-6(2)9(4)7(10)8-3/h2,5H2,1,3-4H3,(H,8,10).
What are the key properties of 1-but-1-en-2-yl-1,3-dimethylurea?
1-but-1-en-2-yl-1,3-dimethylurea has a molecular weight of 142.20 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yl-1,3-dimethylurea is sourced from PubChem (CID 170053729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).