About N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine
N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine (PubChem CID 170054123) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine.
Molecular Properties
| Compound Name | N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine |
| PubChem CID | 170054123 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine |
| SMILES | CC/C=C(\C=C(C)C)N(C)C1CCOCC1 |
| InChI | InChI=1S/C14H25NO/c1-5-6-14(11-12(2)3)15(4)13-7-9-16-10-8-13/h6,11,13H,5,7-10H2,1-4H3/b14-6+ |
| InChIKey | XUDRJDSFDHNWTO-MKMNVTDBSA-N |
| XLogP | 3.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine?
The IUPAC name of N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine (CID 170054123) is N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine.
What is the SMILES notation for N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine?
The canonical SMILES for N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine is CC/C=C(\C=C(C)C)N(C)C1CCOCC1.
What is the InChIKey of N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine?
The InChIKey is XUDRJDSFDHNWTO-MKMNVTDBSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-6-14(11-12(2)3)15(4)13-7-9-16-10-8-13/h6,11,13H,5,7-10H2,1-4H3/b14-6+.
What are the key properties of N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine?
N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine has a molecular weight of 223.36 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(4E)-2-methylhepta-2,4-dien-4-yl]oxan-4-amine is sourced from PubChem (CID 170054123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).