C19H36INO — CID 170054254
3-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine (PubChem CID 170054254) has the molecular formula C19H36INO and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170054254 |
| Molecular Formula | C19H36INO |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCCCC/C=C(/CI)CC/C=C(/C)COCCCN(C)C |
| InChI | InChI=1S/C19H36INO/c1-5-6-7-8-12-19(16-20)13-9-11-18(2)17-22-15-10-14-21(3)4/h11-12H,5-10,13-17H2,1-4H3/b18-11-,19-12+ |
| InChIKey | XFPQQINRKCULCX-VHVWWYSBSA-N |
| XLogP | 5.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|