C23H49NO — CID 170054282
5-(2-heptylnonoxy)-N,N-dimethylpentan-1-amine (PubChem CID 170054282) has the molecular formula C23H49NO and a molecular weight of 355.65 g/mol. Its IUPAC name is 5-(2-heptylnonoxy)-N,N-dimethylpentan-1-amine.
| Compound Name | 5-(2-heptylnonoxy)-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 170054282 |
| Molecular Formula | C23H49NO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.38 |
| IUPAC Name | 5-(2-heptylnonoxy)-N,N-dimethylpentan-1-amine |
| SMILES | CCCCCCCC(CCCCCCC)COCCCCCN(C)C |
| InChI | InChI=1S/C23H49NO/c1-5-7-9-11-14-18-23(19-15-12-10-8-6-2)22-25-21-17-13-16-20-24(3)4/h23H,5-22H2,1-4H3 |
| InChIKey | PBSHJJAJNVKVPH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|