About (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine
(3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine (PubChem CID 170054554) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine.
Molecular Properties
| Compound Name | (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine |
| PubChem CID | 170054554 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine |
| SMILES | C=C/C=N/C1=NC(=N\C=C)/C(=C\CC=C)C=C1C=C |
| InChI | InChI=1S/C16H17N3/c1-5-9-10-14-12-13(7-3)15(18-11-6-2)19-16(14)17-8-4/h5-8,10-12H,1-4,9H2/b14-10-,17-16-,18-11+ |
| InChIKey | WZCIYFVKAOHBGU-NWFZQVFJSA-N |
| XLogP | 3.81 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine?
The IUPAC name of (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine (CID 170054554) is (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine.
What is the SMILES notation for (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine?
The canonical SMILES for (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine is C=C/C=N/C1=NC(=N\C=C)/C(=C\CC=C)C=C1C=C.
What is the InChIKey of (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine?
The InChIKey is WZCIYFVKAOHBGU-NWFZQVFJSA-N. The full InChI is InChI=1S/C16H17N3/c1-5-9-10-14-12-13(7-3)15(18-11-6-2)19-16(14)17-8-4/h5-8,10-12H,1-4,9H2/b14-10-,17-16-,18-11+.
What are the key properties of (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine?
(3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine has a molecular weight of 251.33 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-but-3-enylidene-N,5-bis(ethenyl)-6-(prop-2-enylideneamino)pyridin-2-imine is sourced from PubChem (CID 170054554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).