About 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide
4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide (PubChem CID 170055109) has the molecular formula C23H22FIN2O2
and a molecular weight of 504.34 g/mol. Its IUPAC name is 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide |
| PubChem CID | 170055109 |
| Molecular Formula | C23H22FIN2O2 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccnc(COc3ccc(C(C)(F)I)cc3)c2)cc1C |
| InChI | InChI=1S/C23H22FIN2O2/c1-15-12-16(4-9-21(15)22(28)26-3)17-10-11-27-19(13-17)14-29-20-7-5-18(6-8-20)23(2,24)25/h4-13H,14H2,1-3H3,(H,26,28) |
| InChIKey | KLMAAROOQPSHCJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide?
The IUPAC name of 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide (CID 170055109) is 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide.
What is the SMILES notation for 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide?
The canonical SMILES for 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide is CNC(=O)c1ccc(-c2ccnc(COc3ccc(C(C)(F)I)cc3)c2)cc1C.
What is the InChIKey of 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide?
The InChIKey is KLMAAROOQPSHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FIN2O2/c1-15-12-16(4-9-21(15)22(28)26-3)17-10-11-27-19(13-17)14-29-20-7-5-18(6-8-20)23(2,24)25/h4-13H,14H2,1-3H3,(H,26,28).
What are the key properties of 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide?
4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide has a molecular weight of 504.34 g/mol, XLogP of 5.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[4-(1-fluoro-1-iodoethyl)phenoxy]methyl]-4-pyridinyl]-N,2-dimethylbenzamide is sourced from PubChem (CID 170055109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).