C16H14F2O2 — CID 170055273
benzyl 2,2-difluoro-2-(4-methylphenyl)acetate (PubChem CID 170055273) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is benzyl 2,2-difluoro-2-(4-methylphenyl)acetate.
| Compound Name | benzyl 2,2-difluoro-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 170055273 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | benzyl 2,2-difluoro-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(F)(F)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H14F2O2/c1-12-7-9-14(10-8-12)16(17,18)15(19)20-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | YFRWSJDQIZUUAW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |