C10H16N2 — CID 170055350
1-(5-ethenyl-2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-N-methylmethanimine (PubChem CID 170055350) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(5-ethenyl-2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-N-methylmethanimine.
| Compound Name | 1-(5-ethenyl-2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 170055350 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-(5-ethenyl-2-methyl-1,2,3,6-tetrahydropyridin-4-yl)-N-methylmethanimine |
| SMILES | C=CC1=C(/C=N/C)CC(C)NC1 |
| InChI | InChI=1S/C10H16N2/c1-4-9-7-12-8(2)5-10(9)6-11-3/h4,6,8,12H,1,5,7H2,2-3H3/b11-6+ |
| InChIKey | BXQYZXXXAHULFC-IZZDOVSWSA-N |
| XLogP | 1.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|