C17H29N3O — CID 170055523
[(2R,3S)-3-cyclopropylaziridin-2-yl]-(5-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl)methanone (PubChem CID 170055523) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is [(2R,3S)-3-cyclopropylaziridin-2-yl]-(5-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl)methanone.
| Compound Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-(5-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl)methanone |
|---|---|
| PubChem CID | 170055523 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-(5-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl)methanone |
| SMILES | CC(C)N1CCCC2C1CCCN2C(=O)[C@@H]1N[C@H]1C1CC1 |
| InChI | InChI=1S/C17H29N3O/c1-11(2)19-9-3-6-14-13(19)5-4-10-20(14)17(21)16-15(18-16)12-7-8-12/h11-16,18H,3-10H2,1-2H3/t13?,14?,15-,16+/m0/s1 |
| InChIKey | UHGCTQDATGKDDV-SSHXOBKSSA-N |
| XLogP | 1.60 |
| TPSA | 45.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|