About 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole
2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole (PubChem CID 170056011) has the molecular formula C17H17FN2
and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole.
Molecular Properties
| Compound Name | 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole |
| PubChem CID | 170056011 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole |
| SMILES | C=C1CCC(n2c(=C)c3ccc(F)cc3c2=C)C(=C)N1 |
| InChI | InChI=1S/C17H17FN2/c1-10-5-8-17(11(2)19-10)20-12(3)15-7-6-14(18)9-16(15)13(20)4/h6-7,9,17,19H,1-5,8H2 |
| InChIKey | PSEXWQDOYVEVQP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole?
The IUPAC name of 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole (CID 170056011) is 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole.
What is the SMILES notation for 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole?
The canonical SMILES for 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole is C=C1CCC(n2c(=C)c3ccc(F)cc3c2=C)C(=C)N1.
What is the InChIKey of 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole?
The InChIKey is PSEXWQDOYVEVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2/c1-10-5-8-17(11(2)19-10)20-12(3)15-7-6-14(18)9-16(15)13(20)4/h6-7,9,17,19H,1-5,8H2.
What are the key properties of 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole?
2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole has a molecular weight of 268.33 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylidenepiperidin-3-yl)-5-fluoro-1,3-dimethylideneisoindole is sourced from PubChem (CID 170056011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).