C27H30FN5O5 — CID 170056115
[(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate (PubChem CID 170056115) has the molecular formula C27H30FN5O5 and a molecular weight of 523.57 g/mol. Its IUPAC name is [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170056115 |
| Molecular Formula | C27H30FN5O5 |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [(2S,5R)-5-cyano-5-[4-[3-(4-fluorophenyl)propanoylamino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC[C@@H]1CC[C@](C#N)(c2ccc3c(NC(=O)CCc4ccc(F)cc4)ncnn23)O1 |
| InChI | InChI=1S/C27H30FN5O5/c1-26(2,3)25(35)37-17-36-14-20-12-13-27(15-29,38-20)22-10-9-21-24(30-16-31-33(21)22)32-23(34)11-6-18-4-7-19(28)8-5-18/h4-5,7-10,16,20H,6,11-14,17H2,1-3H3,(H,30,31,32,34)/t20-,27-/m0/s1 |
| InChIKey | IZULTPDEURPQIX-DCFHFQCYSA-N |
| XLogP | 3.90 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|