About 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one
4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 170056263) has the molecular formula C12H16F3N3O
and a molecular weight of 275.27 g/mol. Its IUPAC name is 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| PubChem CID | 170056263 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@@H]1CCC[C@H](Nc2cn[nH]c(=O)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F3N3O/c1-7-3-2-4-8(5-7)17-9-6-16-18-11(19)10(9)12(13,14)15/h6-8H,2-5H2,1H3,(H2,17,18,19)/t7-,8+/m1/s1 |
| InChIKey | ZINASYQXZZDVNX-SFYZADRCSA-N |
| XLogP | 2.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The IUPAC name of 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (CID 170056263) is 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
What is the SMILES notation for 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The canonical SMILES for 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one is C[C@@H]1CCC[C@H](Nc2cn[nH]c(=O)c2C(F)(F)F)C1.
What is the InChIKey of 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The InChIKey is ZINASYQXZZDVNX-SFYZADRCSA-N. The full InChI is InChI=1S/C12H16F3N3O/c1-7-3-2-4-8(5-7)17-9-6-16-18-11(19)10(9)12(13,14)15/h6-8H,2-5H2,1H3,(H2,17,18,19)/t7-,8+/m1/s1.
What are the key properties of 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one?
4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one has a molecular weight of 275.27 g/mol, XLogP of 2.78, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,3R)-3-methylcyclohexyl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one is sourced from PubChem (CID 170056263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).