C33H32FN3O4 — CID 170056374
methyl (E)-3-[3-[[(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]-[hydroxy-[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate (PubChem CID 170056374) has the molecular formula C33H32FN3O4 and a molecular weight of 553.63 g/mol. Its IUPAC name is methyl (E)-3-[3-[[(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]-[hydroxy-[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]-[hydroxy-[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 170056374 |
| Molecular Formula | C33H32FN3O4 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | methyl (E)-3-[3-[[(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]-[hydroxy-[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)cc(N(C(=O)[C@@H]2C[C@@H]3CC[C@H]2C3)C(O)c2ccc(-c3ccc4c(cnn4C)c3)cc2)c1 |
| InChI | InChI=1S/C33H32FN3O4/c1-36-30-11-10-24(17-26(30)19-35-36)22-6-8-23(9-7-22)32(39)37(33(40)29-16-20-3-5-25(29)13-20)28-15-21(14-27(34)18-28)4-12-31(38)41-2/h4,6-12,14-15,17-20,25,29,32,39H,3,5,13,16H2,1-2H3/b12-4+/t20-,25+,29-,32?/m1/s1 |
| InChIKey | ZTZIXLOCOINASW-GNEKLFIOSA-N |
| XLogP | 6.03 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|