C13H13NO — CID 170056766
2-ethyl-4-methylfuro[3,2-b]indole (PubChem CID 170056766) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-ethyl-4-methylfuro[3,2-b]indole.
| Compound Name | 2-ethyl-4-methylfuro[3,2-b]indole |
|---|---|
| PubChem CID | 170056766 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-ethyl-4-methylfuro[3,2-b]indole |
| SMILES | CCc1cc2c(o1)c1ccccc1n2C |
| InChI | InChI=1S/C13H13NO/c1-3-9-8-12-13(15-9)10-6-4-5-7-11(10)14(12)2/h4-8H,3H2,1-2H3 |
| InChIKey | WONPLIYGFLTNGQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |