About 2-ethyl-4-methylfuro[3,2-b]indole
2-ethyl-4-methylfuro[3,2-b]indole (PubChem CID 170056766) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-ethyl-4-methylfuro[3,2-b]indole.
Molecular Properties
| Compound Name | 2-ethyl-4-methylfuro[3,2-b]indole |
| PubChem CID | 170056766 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-ethyl-4-methylfuro[3,2-b]indole |
| SMILES | CCc1cc2c(o1)c1ccccc1n2C |
| InChI | InChI=1S/C13H13NO/c1-3-9-8-12-13(15-9)10-6-4-5-7-11(10)14(12)2/h4-8H,3H2,1-2H3 |
| InChIKey | WONPLIYGFLTNGQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-methylfuro[3,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methylfuro[3,2-b]indole?
The IUPAC name of 2-ethyl-4-methylfuro[3,2-b]indole (CID 170056766) is 2-ethyl-4-methylfuro[3,2-b]indole.
What is the SMILES notation for 2-ethyl-4-methylfuro[3,2-b]indole?
The canonical SMILES for 2-ethyl-4-methylfuro[3,2-b]indole is CCc1cc2c(o1)c1ccccc1n2C.
What is the InChIKey of 2-ethyl-4-methylfuro[3,2-b]indole?
The InChIKey is WONPLIYGFLTNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-3-9-8-12-13(15-9)10-6-4-5-7-11(10)14(12)2/h4-8H,3H2,1-2H3.
What are the key properties of 2-ethyl-4-methylfuro[3,2-b]indole?
2-ethyl-4-methylfuro[3,2-b]indole has a molecular weight of 199.25 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methylfuro[3,2-b]indole is sourced from PubChem (CID 170056766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).