C18H27F3N2O4 — CID 170057171
methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[methyl-(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 170057171) has the molecular formula C18H27F3N2O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[methyl-(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[methyl-(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 170057171 |
| Molecular Formula | C18H27F3N2O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | methyl (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[methyl-(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](N(C)C(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C18H27F3N2O4/c1-16(2,3)12(22(6)15(26)18(19,20)21)13(24)23-8-9-10(17(9,4)5)11(23)14(25)27-7/h9-12H,8H2,1-7H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | FYQDWGMMSJZSHU-FIQHERPVSA-N |
| XLogP | 2.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |