C27H27N3O — CID 17005726
4-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 17005726) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005726 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 4-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(Cn2c(C3CC(=O)N(CCc4ccccc4)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H27N3O/c1-20-11-13-22(14-12-20)18-30-25-10-6-5-9-24(25)28-27(30)23-17-26(31)29(19-23)16-15-21-7-3-2-4-8-21/h2-14,23H,15-19H2,1H3 |
| InChIKey | RYRBNOFQAVYMRJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |