C29H25Cl2FN8O3 — CID 170057318
N-[4-amino-3-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-(3-fluorophenyl)propanamide (PubChem CID 170057318) has the molecular formula C29H25Cl2FN8O3 and a molecular weight of 623.48 g/mol. Its IUPAC name is N-[4-amino-3-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-(3-fluorophenyl)propanamide.
| Compound Name | N-[4-amino-3-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 170057318 |
| Molecular Formula | C29H25Cl2FN8O3 |
| Molecular Weight | 623.48 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | N-[4-amino-3-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-(3-fluorophenyl)propanamide |
| SMILES | C/N=C/c1cc(NC(=O)C(Cc2cccc(F)c2)N2CC(=O)N(c3cc(Cl)ccc3-n3cc(Cl)nn3)CC2=O)ccc1N |
| InChI | InChI=1S/C29H25Cl2FN8O3/c1-34-13-18-11-21(6-7-22(18)33)35-29(43)25(10-17-3-2-4-20(32)9-17)39-16-27(41)38(15-28(39)42)24-12-19(30)5-8-23(24)40-14-26(31)36-37-40/h2-9,11-14,25H,10,15-16,33H2,1H3,(H,35,43)/b34-13+ |
| InChIKey | XKJBBKYDHJWSCV-RPUDKEGQSA-N |
| XLogP | 3.77 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|