C12H11NOS — CID 170057452
2,3,4,6-tetrahydrothiopyrano[3,2-c]quinolin-5-one (PubChem CID 170057452) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 2,3,4,6-tetrahydrothiopyrano[3,2-c]quinolin-5-one.
| Compound Name | 2,3,4,6-tetrahydrothiopyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 170057452 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2,3,4,6-tetrahydrothiopyrano[3,2-c]quinolin-5-one |
| SMILES | O=c1[nH]c2ccccc2c2c1CCCS2 |
| InChI | InChI=1S/C12H11NOS/c14-12-9-5-3-7-15-11(9)8-4-1-2-6-10(8)13-12/h1-2,4,6H,3,5,7H2,(H,13,14) |
| InChIKey | KXBFBUJBTZFCLM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |