C23H31N7O2 — CID 170058243
N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[(dimethylamino)methyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 170058243) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[(dimethylamino)methyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[(dimethylamino)methyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 170058243 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-2-[(2R,5S)-2-[3-[(dimethylamino)methyl]phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | [H]/N=C/c1c(N)ncc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2cccc(CN(C)C)c2)c1N |
| InChI | InChI=1S/C23H31N7O2/c1-14-7-8-19(16-6-4-5-15(9-16)13-29(2)3)30(12-14)23(32)22(31)28-18-11-27-21(26)17(10-24)20(18)25/h4-6,9-11,14,19,24H,7-8,12-13H2,1-3H3,(H,28,31)(H4,25,26,27)/b24-10+/t14-,19+/m0/s1 |
| InChIKey | LGDRUYJJEQSKEN-ZWXOMXBVSA-N |
| XLogP | 2.24 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|