C26H30F4N6 — CID 170058913
N-(1-butylpyrrolidin-3-yl)-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine (PubChem CID 170058913) has the molecular formula C26H30F4N6 and a molecular weight of 502.56 g/mol. Its IUPAC name is N-(1-butylpyrrolidin-3-yl)-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine.
| Compound Name | N-(1-butylpyrrolidin-3-yl)-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 170058913 |
| Molecular Formula | C26H30F4N6 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-(1-butylpyrrolidin-3-yl)-5-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]pyrazin-2-amine |
| SMILES | CCCCN1CCC(Nc2cnc(C3=C(CC(F)(F)F)CCCc4c3ccc3n[nH]c(F)c43)cn2)C1 |
| InChI | InChI=1S/C26H30F4N6/c1-2-3-10-36-11-9-17(15-36)33-22-14-31-21(13-32-22)23-16(12-26(28,29)30)5-4-6-18-19(23)7-8-20-24(18)25(27)35-34-20/h7-8,13-14,17H,2-6,9-12,15H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | KUPRYKIKVVWLNO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |