C17H24BrFO5S — CID 170059311
(3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-2,3-di(propan-2-yloxy)oxane (PubChem CID 170059311) has the molecular formula C17H24BrFO5S and a molecular weight of 439.34 g/mol. Its IUPAC name is (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-2,3-di(propan-2-yloxy)oxane.
| Compound Name | (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-2,3-di(propan-2-yloxy)oxane |
|---|---|
| PubChem CID | 170059311 |
| Molecular Formula | C17H24BrFO5S |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (3R,4R)-5-(4-bromophenyl)sulfonyl-4-fluoro-2,3-di(propan-2-yloxy)oxane |
| SMILES | CC(C)OC1OCC(S(=O)(=O)c2ccc(Br)cc2)[C@H](F)[C@@H]1OC(C)C |
| InChI | InChI=1S/C17H24BrFO5S/c1-10(2)23-16-15(19)14(9-22-17(16)24-11(3)4)25(20,21)13-7-5-12(18)6-8-13/h5-8,10-11,14-17H,9H2,1-4H3/t14?,15-,16-,17?/m0/s1 |
| InChIKey | WXISTGRJWYQMBI-YZUHTNEWSA-N |
| XLogP | 3.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |